C39H90N2O12Si4 — CID 140847718
1,9-bis(triethoxysilyl)-4,6-bis(3-triethoxysilylpropyl)nonane-4,6-diamine (PubChem CID 140847718) has the molecular formula C39H90N2O12Si4 and a molecular weight of 891.49 g/mol. Its IUPAC name is 1,9-bis(triethoxysilyl)-4,6-bis(3-triethoxysilylpropyl)nonane-4,6-diamine.
| Compound Name | 1,9-bis(triethoxysilyl)-4,6-bis(3-triethoxysilylpropyl)nonane-4,6-diamine |
|---|---|
| PubChem CID | 140847718 |
| Molecular Formula | C39H90N2O12Si4 |
| Molecular Weight | 891.49 g/mol |
| Exact Mass | 890.56 |
| IUPAC Name | 1,9-bis(triethoxysilyl)-4,6-bis(3-triethoxysilylpropyl)nonane-4,6-diamine |
| SMILES | CCO[Si](CCCC(N)(CCC[Si](OCC)(OCC)OCC)CC(N)(CCC[Si](OCC)(OCC)OCC)CCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C39H90N2O12Si4/c1-13-42-54(43-14-2,44-15-3)33-25-29-38(40,30-26-34-55(45-16-4,46-17-5)47-18-6)37-39(41,31-27-35-56(48-19-7,49-20-8)50-21-9)32-28-36-57(51-22-10,52-23-11)53-24-12/h13-37,40-41H2,1-12H3 |
| InChIKey | QJFUXEHKAMSYHU-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 162.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.49 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|