C16H40N2O2Si2 — CID 21285290
5-[ethoxy(dimethyl)silyl]-2-[3-[ethoxy(dimethyl)silyl]propyl]pentane-1,2-diamine (PubChem CID 21285290) has the molecular formula C16H40N2O2Si2 and a molecular weight of 348.68 g/mol. Its IUPAC name is 5-[ethoxy(dimethyl)silyl]-2-[3-[ethoxy(dimethyl)silyl]propyl]pentane-1,2-diamine.
| Compound Name | 5-[ethoxy(dimethyl)silyl]-2-[3-[ethoxy(dimethyl)silyl]propyl]pentane-1,2-diamine |
|---|---|
| PubChem CID | 21285290 |
| Molecular Formula | C16H40N2O2Si2 |
| Molecular Weight | 348.68 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 5-[ethoxy(dimethyl)silyl]-2-[3-[ethoxy(dimethyl)silyl]propyl]pentane-1,2-diamine |
| SMILES | CCO[Si](C)(C)CCCC(N)(CN)CCC[Si](C)(C)OCC |
| InChI | InChI=1S/C16H40N2O2Si2/c1-7-19-21(3,4)13-9-11-16(18,15-17)12-10-14-22(5,6)20-8-2/h7-15,17-18H2,1-6H3 |
| InChIKey | ZFRHZUIXNRAZPY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.68 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|