C12H27F2O4PSi — CID 58807017
(4-diethoxyphosphoryl-4,4-difluorobutyl)-ethoxy-dimethylsilane (PubChem CID 58807017) has the molecular formula C12H27F2O4PSi and a molecular weight of 332.40 g/mol. Its IUPAC name is (4-diethoxyphosphoryl-4,4-difluorobutyl)-ethoxy-dimethylsilane.
| Compound Name | (4-diethoxyphosphoryl-4,4-difluorobutyl)-ethoxy-dimethylsilane |
|---|---|
| PubChem CID | 58807017 |
| Molecular Formula | C12H27F2O4PSi |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (4-diethoxyphosphoryl-4,4-difluorobutyl)-ethoxy-dimethylsilane |
| SMILES | CCO[Si](C)(C)CCCC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H27F2O4PSi/c1-6-16-19(15,17-7-2)12(13,14)10-9-11-20(4,5)18-8-3/h6-11H2,1-5H3 |
| InChIKey | KYISTZVXTYFISH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|