C9H15F7OSi — CID 59112366
ethoxy-(3,3,4,4,5,5,5-heptafluoropentyl)-dimethylsilane (PubChem CID 59112366) has the molecular formula C9H15F7OSi and a molecular weight of 300.29 g/mol. Its IUPAC name is ethoxy-(3,3,4,4,5,5,5-heptafluoropentyl)-dimethylsilane.
| Compound Name | ethoxy-(3,3,4,4,5,5,5-heptafluoropentyl)-dimethylsilane |
|---|---|
| PubChem CID | 59112366 |
| Molecular Formula | C9H15F7OSi |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | ethoxy-(3,3,4,4,5,5,5-heptafluoropentyl)-dimethylsilane |
| SMILES | CCO[Si](C)(C)CCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H15F7OSi/c1-4-17-18(2,3)6-5-7(10,11)8(12,13)9(14,15)16/h4-6H2,1-3H3 |
| InChIKey | KZIVHKUKVJAACW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|