C8H15F5OSi — CID 59112324
ethoxy-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane (PubChem CID 59112324) has the molecular formula C8H15F5OSi and a molecular weight of 250.28 g/mol. Its IUPAC name is ethoxy-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane.
| Compound Name | ethoxy-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane |
|---|---|
| PubChem CID | 59112324 |
| Molecular Formula | C8H15F5OSi |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | ethoxy-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane |
| SMILES | CCO[Si](C)(C)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H15F5OSi/c1-4-14-15(2,3)6-5-7(9,10)8(11,12)13/h4-6H2,1-3H3 |
| InChIKey | DYKDXGXWBLLCOD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|