C12H21F7OSi — CID 59112365
3,3,4,4,5,5,5-heptafluoropentyl-methoxy-dipropylsilane (PubChem CID 59112365) has the molecular formula C12H21F7OSi and a molecular weight of 342.37 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentyl-methoxy-dipropylsilane.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentyl-methoxy-dipropylsilane |
|---|---|
| PubChem CID | 59112365 |
| Molecular Formula | C12H21F7OSi |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentyl-methoxy-dipropylsilane |
| SMILES | CCC[Si](CCC)(CCC(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C12H21F7OSi/c1-4-7-21(20-3,8-5-2)9-6-10(13,14)11(15,16)12(17,18)19/h4-9H2,1-3H3 |
| InChIKey | FMMBXEAKMXWKJY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|