C8H13F7O3Si — CID 52991970
3,3,4,4,5,5,5-heptafluoropentyl(trimethoxy)silane (PubChem CID 52991970) has the molecular formula C8H13F7O3Si and a molecular weight of 318.26 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentyl(trimethoxy)silane.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentyl(trimethoxy)silane |
|---|---|
| PubChem CID | 52991970 |
| Molecular Formula | C8H13F7O3Si |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentyl(trimethoxy)silane |
| SMILES | CO[Si](CCC(F)(F)C(F)(F)C(F)(F)F)(OC)OC |
| InChI | InChI=1S/C8H13F7O3Si/c1-16-19(17-2,18-3)5-4-6(9,10)7(11,12)8(13,14)15/h4-5H2,1-3H3 |
| InChIKey | SIUOAIYCRNJMLQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|