C10H19F2O3PSi — CID 71662126
(3-diethoxyphosphoryl-3,3-difluoroprop-1-ynyl)-trimethylsilane (PubChem CID 71662126) has the molecular formula C10H19F2O3PSi and a molecular weight of 284.31 g/mol. Its IUPAC name is (3-diethoxyphosphoryl-3,3-difluoroprop-1-ynyl)-trimethylsilane.
| Compound Name | (3-diethoxyphosphoryl-3,3-difluoroprop-1-ynyl)-trimethylsilane |
|---|---|
| PubChem CID | 71662126 |
| Molecular Formula | C10H19F2O3PSi |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (3-diethoxyphosphoryl-3,3-difluoroprop-1-ynyl)-trimethylsilane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C#C[Si](C)(C)C |
| InChI | InChI=1S/C10H19F2O3PSi/c1-6-14-16(13,15-7-2)10(11,12)8-9-17(3,4)5/h6-7H2,1-5H3 |
| InChIKey | OHQAQCAPNYGQLB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|