C12H24BF2O5P — CID 102527295
2-(2-diethoxyphosphoryl-2,2-difluoroethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102527295) has the molecular formula C12H24BF2O5P and a molecular weight of 328.10 g/mol. Its IUPAC name is 2-(2-diethoxyphosphoryl-2,2-difluoroethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2-diethoxyphosphoryl-2,2-difluoroethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102527295 |
| Molecular Formula | C12H24BF2O5P |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-(2-diethoxyphosphoryl-2,2-difluoroethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOP(=O)(OCC)C(F)(F)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H24BF2O5P/c1-7-17-21(16,18-8-2)12(14,15)9-13-19-10(3,4)11(5,6)20-13/h7-9H2,1-6H3 |
| InChIKey | BCZUSJVPTRFRDI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|