C14H29BClO5P — CID 11439650
2-(4-chloro-4-diethoxyphosphorylbutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 11439650) has the molecular formula C14H29BClO5P and a molecular weight of 354.62 g/mol. Its IUPAC name is 2-(4-chloro-4-diethoxyphosphorylbutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4-chloro-4-diethoxyphosphorylbutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11439650 |
| Molecular Formula | C14H29BClO5P |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-(4-chloro-4-diethoxyphosphorylbutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOP(=O)(OCC)C(Cl)CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H29BClO5P/c1-7-18-22(17,19-8-2)12(16)10-9-11-15-20-13(3,4)14(5,6)21-15/h12H,7-11H2,1-6H3 |
| InChIKey | HHFSMMXLLSPNPS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|