C19H39BO4 — CID 144950021
2-butyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanal;methoxyethane (PubChem CID 144950021) has the molecular formula C19H39BO4 and a molecular weight of 342.33 g/mol. Its IUPAC name is 2-butyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanal;methoxyethane.
| Compound Name | 2-butyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanal;methoxyethane |
|---|---|
| PubChem CID | 144950021 |
| Molecular Formula | C19H39BO4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | 2-butyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanal;methoxyethane |
| SMILES | CCCCC(C=O)CCCCB1OC(C)(C)C(C)(C)O1.CCOC |
| InChI | InChI=1S/C16H31BO3.C3H8O/c1-6-7-10-14(13-18)11-8-9-12-17-19-15(2,3)16(4,5)20-17;1-3-4-2/h13-14H,6-12H2,1-5H3;3H2,1-2H3 |
| InChIKey | IOJIBILLPKOSSY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|