About 2-(2,2-diethoxyethyl)hexanal
2-(2,2-diethoxyethyl)hexanal (PubChem CID 121007573) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)hexanal.
Molecular Properties
| Compound Name | 2-(2,2-diethoxyethyl)hexanal |
| PubChem CID | 121007573 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 2-(2,2-diethoxyethyl)hexanal |
| SMILES | CCCCC(C=O)CC(OCC)OCC |
| InChI | InChI=1S/C12H24O3/c1-4-7-8-11(10-13)9-12(14-5-2)15-6-3/h10-12H,4-9H2,1-3H3 |
| InChIKey | JNFWZLPXHSICTE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-diethoxyethyl)hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-diethoxyethyl)hexanal?
The IUPAC name of 2-(2,2-diethoxyethyl)hexanal (CID 121007573) is 2-(2,2-diethoxyethyl)hexanal.
What is the SMILES notation for 2-(2,2-diethoxyethyl)hexanal?
The canonical SMILES for 2-(2,2-diethoxyethyl)hexanal is CCCCC(C=O)CC(OCC)OCC.
What is the InChIKey of 2-(2,2-diethoxyethyl)hexanal?
The InChIKey is JNFWZLPXHSICTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-4-7-8-11(10-13)9-12(14-5-2)15-6-3/h10-12H,4-9H2,1-3H3.
What are the key properties of 2-(2,2-diethoxyethyl)hexanal?
2-(2,2-diethoxyethyl)hexanal has a molecular weight of 216.32 g/mol, XLogP of 2.78, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethoxyethyl)hexanal is sourced from PubChem (CID 121007573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).