C12H24BIO3S — CID 144675497
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy thiohypoiodite (PubChem CID 144675497) has the molecular formula C12H24BIO3S and a molecular weight of 386.10 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy thiohypoiodite.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy thiohypoiodite |
|---|---|
| PubChem CID | 144675497 |
| Molecular Formula | C12H24BIO3S |
| Molecular Weight | 386.10 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy thiohypoiodite |
| SMILES | CC1(C)OB(CCCCCCOSI)OC1(C)C |
| InChI | InChI=1S/C12H24BIO3S/c1-11(2)12(3,4)17-13(16-11)9-7-5-6-8-10-15-18-14/h5-10H2,1-4H3 |
| InChIKey | ZBGAEXSDTJSFRD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.10 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|