C15H30BF3O2 — CID 143087872
ethane;4,4,5,5-tetramethyl-2-(5,5,5-trifluoro-4,4-dimethylpentyl)-1,3,2-dioxaborolane (PubChem CID 143087872) has the molecular formula C15H30BF3O2 and a molecular weight of 310.21 g/mol. Its IUPAC name is ethane;4,4,5,5-tetramethyl-2-(5,5,5-trifluoro-4,4-dimethylpentyl)-1,3,2-dioxaborolane.
| Compound Name | ethane;4,4,5,5-tetramethyl-2-(5,5,5-trifluoro-4,4-dimethylpentyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 143087872 |
| Molecular Formula | C15H30BF3O2 |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | ethane;4,4,5,5-tetramethyl-2-(5,5,5-trifluoro-4,4-dimethylpentyl)-1,3,2-dioxaborolane |
| SMILES | CC.CC(C)(CCCB1OC(C)(C)C(C)(C)O1)C(F)(F)F |
| InChI | InChI=1S/C13H24BF3O2.C2H6/c1-10(2,13(15,16)17)8-7-9-14-18-11(3,4)12(5,6)19-14;1-2/h7-9H2,1-6H3;1-2H3 |
| InChIKey | JDVXBBFKNMZQTJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|