C13H21BF6O2 — CID 143087891
4,4,5,5-tetramethyl-2-[5,5,5-trifluoro-4-methyl-4-(trifluoromethyl)pentyl]-1,3,2-dioxaborolane (PubChem CID 143087891) has the molecular formula C13H21BF6O2 and a molecular weight of 334.11 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[5,5,5-trifluoro-4-methyl-4-(trifluoromethyl)pentyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[5,5,5-trifluoro-4-methyl-4-(trifluoromethyl)pentyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 143087891 |
| Molecular Formula | C13H21BF6O2 |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[5,5,5-trifluoro-4-methyl-4-(trifluoromethyl)pentyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(CCCC(C)(C(F)(F)F)C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C13H21BF6O2/c1-9(2)10(3,4)22-14(21-9)8-6-7-11(5,12(15,16)17)13(18,19)20/h6-8H2,1-5H3 |
| InChIKey | CLOUZJDYKVRUIT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|