C15H32B2O2 — CID 86177372
diethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]borane (PubChem CID 86177372) has the molecular formula C15H32B2O2 and a molecular weight of 266.04 g/mol. Its IUPAC name is diethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]borane.
| Compound Name | diethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]borane |
|---|---|
| PubChem CID | 86177372 |
| Molecular Formula | C15H32B2O2 |
| Molecular Weight | 266.04 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | diethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]borane |
| SMILES | CCB(CC)CCCCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H32B2O2/c1-7-16(8-2)12-10-9-11-13-17-18-14(3,4)15(5,6)19-17/h7-13H2,1-6H3 |
| InChIKey | DKLXNQRNQUBOHX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.04 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|