C11H25BO2 — CID 143883669
2-ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;propane (PubChem CID 143883669) has the molecular formula C11H25BO2 and a molecular weight of 200.13 g/mol. Its IUPAC name is 2-ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;propane.
| Compound Name | 2-ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;propane |
|---|---|
| PubChem CID | 143883669 |
| Molecular Formula | C11H25BO2 |
| Molecular Weight | 200.13 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;propane |
| SMILES | CCB1OC(C)(C)C(C)(C)O1.CCC |
| InChI | InChI=1S/C8H17BO2.C3H8/c1-6-9-10-7(2,3)8(4,5)11-9;1-3-2/h6H2,1-5H3;3H2,1-2H3 |
| InChIKey | YAXULZUEPLNSJZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.13 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|