C15H32BO5P — CID 100963635
2-(1-diethoxyphosphoryl-2,2-dimethylpropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 100963635) has the molecular formula C15H32BO5P and a molecular weight of 334.20 g/mol. Its IUPAC name is 2-(1-diethoxyphosphoryl-2,2-dimethylpropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1-diethoxyphosphoryl-2,2-dimethylpropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 100963635 |
| Molecular Formula | C15H32BO5P |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-(1-diethoxyphosphoryl-2,2-dimethylpropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOP(=O)(OCC)C(B1OC(C)(C)C(C)(C)O1)C(C)(C)C |
| InChI | InChI=1S/C15H32BO5P/c1-10-18-22(17,19-11-2)12(13(3,4)5)16-20-14(6,7)15(8,9)21-16/h12H,10-11H2,1-9H3 |
| InChIKey | AICYBAZEWCGVAY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|