C9H20NO6P — CID 141164553
(1-diethoxyphosphoryl-2,2-dimethylpropyl) nitrate (PubChem CID 141164553) has the molecular formula C9H20NO6P and a molecular weight of 269.23 g/mol. Its IUPAC name is (1-diethoxyphosphoryl-2,2-dimethylpropyl) nitrate.
| Compound Name | (1-diethoxyphosphoryl-2,2-dimethylpropyl) nitrate |
|---|---|
| PubChem CID | 141164553 |
| Molecular Formula | C9H20NO6P |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (1-diethoxyphosphoryl-2,2-dimethylpropyl) nitrate |
| SMILES | CCOP(=O)(OCC)C(O[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C9H20NO6P/c1-6-14-17(13,15-7-2)8(9(3,4)5)16-10(11)12/h8H,6-7H2,1-5H3 |
| InChIKey | CKTDTYIHMAQLDH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|