C12H28NO4P — CID 20751673
N-tert-butyl-N-[1-[ethoxy(methoxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine (PubChem CID 20751673) has the molecular formula C12H28NO4P and a molecular weight of 281.33 g/mol. Its IUPAC name is N-tert-butyl-N-[1-[ethoxy(methoxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine.
| Compound Name | N-tert-butyl-N-[1-[ethoxy(methoxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine |
|---|---|
| PubChem CID | 20751673 |
| Molecular Formula | C12H28NO4P |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-tert-butyl-N-[1-[ethoxy(methoxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine |
| SMILES | CCOP(=O)(OC)C(N(O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H28NO4P/c1-9-17-18(15,16-8)10(11(2,3)4)13(14)12(5,6)7/h10,14H,9H2,1-8H3 |
| InChIKey | LGSZOEZXYQCINO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|