C14H32NO4P — CID 91262510
N-tert-butyl-N-[1-[ethoxy(propan-2-yloxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine (PubChem CID 91262510) has the molecular formula C14H32NO4P and a molecular weight of 309.39 g/mol. Its IUPAC name is N-tert-butyl-N-[1-[ethoxy(propan-2-yloxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine.
| Compound Name | N-tert-butyl-N-[1-[ethoxy(propan-2-yloxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine |
|---|---|
| PubChem CID | 91262510 |
| Molecular Formula | C14H32NO4P |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-tert-butyl-N-[1-[ethoxy(propan-2-yloxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine |
| SMILES | CCOP(=O)(OC(C)C)C(N(O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H32NO4P/c1-10-18-20(17,19-11(2)3)12(13(4,5)6)15(16)14(7,8)9/h11-12,16H,10H2,1-9H3 |
| InChIKey | SJDLDGKUEPCVFE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|