C30H66N2O10P2 — CID 163621446
2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxypropan-2-yl formate;N-tert-butyl-N-(1-diethoxyphosphoryl-2,2-dimethylpropyl)hydroxylamine (PubChem CID 163621446) has the molecular formula C30H66N2O10P2 and a molecular weight of 676.81 g/mol. Its IUPAC name is 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxypropan-2-yl formate;N-tert-butyl-N-(1-diethoxyphosphoryl-2,2-dimethylpropyl)hydroxylamine.
| Compound Name | 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxypropan-2-yl formate;N-tert-butyl-N-(1-diethoxyphosphoryl-2,2-dimethylpropyl)hydroxylamine |
|---|---|
| PubChem CID | 163621446 |
| Molecular Formula | C30H66N2O10P2 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.42 |
| IUPAC Name | 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxypropan-2-yl formate;N-tert-butyl-N-(1-diethoxyphosphoryl-2,2-dimethylpropyl)hydroxylamine |
| SMILES | CCOP(=O)(OCC)C(N(O)C(C)(C)C)C(C)(C)C.CCOP(=O)(OCC)C(N(OC(C)(C)OC=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H36NO6P.C13H30NO4P/c1-11-22-25(20,23-12-2)14(15(3,4)5)18(16(6,7)8)24-17(9,10)21-13-19;1-9-17-19(16,18-10-2)11(12(3,4)5)14(15)13(6,7)8/h13-14H,11-12H2,1-10H3;11,15H,9-10H2,1-8H3 |
| InChIKey | HOLMOZGEAVUOLP-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|