C15H32NO6P — CID 89397790
2-[tert-butyl(1-diethoxyphosphorylpropyl)amino]oxy-2-methylpropanoic acid (PubChem CID 89397790) has the molecular formula C15H32NO6P and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[tert-butyl(1-diethoxyphosphorylpropyl)amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[tert-butyl(1-diethoxyphosphorylpropyl)amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 89397790 |
| Molecular Formula | C15H32NO6P |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-[tert-butyl(1-diethoxyphosphorylpropyl)amino]oxy-2-methylpropanoic acid |
| SMILES | CCOP(=O)(OCC)C(CC)N(OC(C)(C)C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H32NO6P/c1-9-12(23(19,20-10-2)21-11-3)16(14(4,5)6)22-15(7,8)13(17)18/h12H,9-11H2,1-8H3,(H,17,18) |
| InChIKey | RPDHOWHAIUBXDJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|