C28H56NO6P — CID 102290558
undec-10-enyl 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-methylpropanoate (PubChem CID 102290558) has the molecular formula C28H56NO6P and a molecular weight of 533.73 g/mol. Its IUPAC name is undec-10-enyl 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-methylpropanoate.
| Compound Name | undec-10-enyl 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 102290558 |
| Molecular Formula | C28H56NO6P |
| Molecular Weight | 533.73 g/mol |
| Exact Mass | 533.38 |
| IUPAC Name | undec-10-enyl 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-methylpropanoate |
| SMILES | C=CCCCCCCCCCOC(=O)C(C)(C)ON(C(C(C)(C)C)P(=O)(OCC)OCC)C(C)(C)C |
| InChI | InChI=1S/C28H56NO6P/c1-12-15-16-17-18-19-20-21-22-23-32-25(30)28(10,11)35-29(27(7,8)9)24(26(4,5)6)36(31,33-13-2)34-14-3/h12,24H,1,13-23H2,2-11H3 |
| InChIKey | QFZACMASKBHAAE-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.73 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|