C17H35NNaO6P — CID 11407007
sodium 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-methylpropanoate (PubChem CID 11407007) has the molecular formula C17H35NNaO6P and a molecular weight of 403.43 g/mol. Its IUPAC name is sodium 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-methylpropanoate.
| Compound Name | sodium 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 11407007 |
| Molecular Formula | C17H35NNaO6P |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | sodium 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-methylpropanoate |
| SMILES | CCOP(=O)(OCC)C(N(OC(C)(C)C(=O)[O-])C(C)(C)C)C(C)(C)C.[Na+] |
| InChI | InChI=1S/C17H36NO6P.Na/c1-11-22-25(21,23-12-2)13(15(3,4)5)18(16(6,7)8)24-17(9,10)14(19)20;/h13H,11-12H2,1-10H3,(H,19,20);/q;+1/p-1 |
| InChIKey | NGDZWCYRIDTFRC-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|