C13H29NO4P — CID 10935280
CID 10935280 (PubChem CID 10935280) has the molecular formula C13H29NO4P and a molecular weight of 294.35 g/mol.
| Compound Name | CID 10935280 |
|---|---|
| PubChem CID | 10935280 |
| Molecular Formula | C13H29NO4P |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | — |
| SMILES | CCOP(=O)(OCC)C(N([O])C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29NO4P/c1-9-17-19(16,18-10-2)11(12(3,4)5)14(15)13(6,7)8/h11H,9-10H2,1-8H3 |
| InChIKey | XVWOLKBRGCIQGK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|