C20H42NO6P — CID 102071689
butyl 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxypropanoate (PubChem CID 102071689) has the molecular formula C20H42NO6P and a molecular weight of 423.53 g/mol. Its IUPAC name is butyl 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxypropanoate.
| Compound Name | butyl 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxypropanoate |
|---|---|
| PubChem CID | 102071689 |
| Molecular Formula | C20H42NO6P |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | butyl 2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxypropanoate |
| SMILES | CCCCOC(=O)C(C)ON(C(C(C)(C)C)P(=O)(OCC)OCC)C(C)(C)C |
| InChI | InChI=1S/C20H42NO6P/c1-11-14-15-24-17(22)16(4)27-21(20(8,9)10)18(19(5,6)7)28(23,25-12-2)26-13-3/h16,18H,11-15H2,1-10H3 |
| InChIKey | BIEWFUMQIBGESW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|