C28H42NO6P — CID 139092936
[(2R)-2-[tert-butyl-[(1R)-1-diethoxyphosphoryl-2,2-dimethylpropyl]amino]oxy-2-phenylethyl] benzoate (PubChem CID 139092936) has the molecular formula C28H42NO6P and a molecular weight of 519.62 g/mol. Its IUPAC name is [(2R)-2-[tert-butyl-[(1R)-1-diethoxyphosphoryl-2,2-dimethylpropyl]amino]oxy-2-phenylethyl] benzoate.
| Compound Name | [(2R)-2-[tert-butyl-[(1R)-1-diethoxyphosphoryl-2,2-dimethylpropyl]amino]oxy-2-phenylethyl] benzoate |
|---|---|
| PubChem CID | 139092936 |
| Molecular Formula | C28H42NO6P |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | [(2R)-2-[tert-butyl-[(1R)-1-diethoxyphosphoryl-2,2-dimethylpropyl]amino]oxy-2-phenylethyl] benzoate |
| SMILES | CCOP(=O)(OCC)[C@@H](N(O[C@@H](COC(=O)c1ccccc1)c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H42NO6P/c1-9-33-36(31,34-10-2)26(27(3,4)5)29(28(6,7)8)35-24(22-17-13-11-14-18-22)21-32-25(30)23-19-15-12-16-20-23/h11-20,24,26H,9-10,21H2,1-8H3/t24-,26+/m0/s1 |
| InChIKey | FHLUOHWSXRPOMZ-AZGAKELHSA-N |
| XLogP | 7.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|