C25H44NO7P — CID 87555628
[2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-phenylethyl] propan-2-yl carbonate (PubChem CID 87555628) has the molecular formula C25H44NO7P and a molecular weight of 501.60 g/mol. Its IUPAC name is [2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-phenylethyl] propan-2-yl carbonate.
| Compound Name | [2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-phenylethyl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 87555628 |
| Molecular Formula | C25H44NO7P |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | [2-[tert-butyl-(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]oxy-2-phenylethyl] propan-2-yl carbonate |
| SMILES | CCOP(=O)(OCC)C(N(OC(COC(=O)OC(C)C)c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H44NO7P/c1-11-30-34(28,31-12-2)22(24(5,6)7)26(25(8,9)10)33-21(20-16-14-13-15-17-20)18-29-23(27)32-19(3)4/h13-17,19,21-22H,11-12,18H2,1-10H3 |
| InChIKey | GWDYZZYXFDVPNA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|