C27H52NO5PSi — CID 102236370
N-tert-butyl-N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethoxy]-1-diethoxyphosphoryl-2,2-dimethylpropan-1-amine (PubChem CID 102236370) has the molecular formula C27H52NO5PSi and a molecular weight of 529.78 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethoxy]-1-diethoxyphosphoryl-2,2-dimethylpropan-1-amine.
| Compound Name | N-tert-butyl-N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethoxy]-1-diethoxyphosphoryl-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 102236370 |
| Molecular Formula | C27H52NO5PSi |
| Molecular Weight | 529.78 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | N-tert-butyl-N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethoxy]-1-diethoxyphosphoryl-2,2-dimethylpropan-1-amine |
| SMILES | CCOP(=O)(OCC)C(N(OC(CO[Si](C)(C)C(C)(C)C)c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H52NO5PSi/c1-14-30-34(29,31-15-2)24(25(3,4)5)28(26(6,7)8)33-23(22-19-17-16-18-20-22)21-32-35(12,13)27(9,10)11/h16-20,23-24H,14-15,21H2,1-13H3 |
| InChIKey | UGHDJASHTXSTAT-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.78 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|