C25H36NO4P-2 — CID 140706107
N-tert-butyl-N-(1,3-diphenylbutoxy)-2,2-dimethyl-1-phosphonatopropan-1-amine (PubChem CID 140706107) has the molecular formula C25H36NO4P-2 and a molecular weight of 445.54 g/mol. Its IUPAC name is N-tert-butyl-N-(1,3-diphenylbutoxy)-2,2-dimethyl-1-phosphonatopropan-1-amine.
| Compound Name | N-tert-butyl-N-(1,3-diphenylbutoxy)-2,2-dimethyl-1-phosphonatopropan-1-amine |
|---|---|
| PubChem CID | 140706107 |
| Molecular Formula | C25H36NO4P-2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | N-tert-butyl-N-(1,3-diphenylbutoxy)-2,2-dimethyl-1-phosphonatopropan-1-amine |
| SMILES | CC(CC(ON(C(C(C)(C)C)P(=O)([O-])[O-])C(C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H38NO4P/c1-19(20-14-10-8-11-15-20)18-22(21-16-12-9-13-17-21)30-26(25(5,6)7)23(24(2,3)4)31(27,28)29/h8-17,19,22-23H,18H2,1-7H3,(H2,27,28,29)/p-2 |
| InChIKey | PMKZUSKSYGLBSP-UHFFFAOYSA-L |
| XLogP | 5.24 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|