C23H31O4P — CID 19357795
3-[benzyl(hydroxy)phosphoryl]-4,4-dimethyl-2-(2-phenylpropyl)pentanoic acid (PubChem CID 19357795) has the molecular formula C23H31O4P and a molecular weight of 402.47 g/mol. Its IUPAC name is 3-[benzyl(hydroxy)phosphoryl]-4,4-dimethyl-2-(2-phenylpropyl)pentanoic acid.
| Compound Name | 3-[benzyl(hydroxy)phosphoryl]-4,4-dimethyl-2-(2-phenylpropyl)pentanoic acid |
|---|---|
| PubChem CID | 19357795 |
| Molecular Formula | C23H31O4P |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-[benzyl(hydroxy)phosphoryl]-4,4-dimethyl-2-(2-phenylpropyl)pentanoic acid |
| SMILES | CC(CC(C(=O)O)C(C(C)(C)C)P(=O)(O)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31O4P/c1-17(19-13-9-6-10-14-19)15-20(22(24)25)21(23(2,3)4)28(26,27)16-18-11-7-5-8-12-18/h5-14,17,20-21H,15-16H2,1-4H3,(H,24,25)(H,26,27) |
| InChIKey | HXQKXICQQVMSPQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|