C14H17NaO4 — CID 101273649
sodium 3-carboxy-2-methyl-5-phenylhexanoate (PubChem CID 101273649) has the molecular formula C14H17NaO4 and a molecular weight of 272.28 g/mol. Its IUPAC name is sodium 3-carboxy-2-methyl-5-phenylhexanoate.
| Compound Name | sodium 3-carboxy-2-methyl-5-phenylhexanoate |
|---|---|
| PubChem CID | 101273649 |
| Molecular Formula | C14H17NaO4 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | sodium 3-carboxy-2-methyl-5-phenylhexanoate |
| SMILES | CC(CC(C(=O)O)C(C)C(=O)[O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C14H18O4.Na/c1-9(11-6-4-3-5-7-11)8-12(14(17)18)10(2)13(15)16;/h3-7,9-10,12H,8H2,1-2H3,(H,15,16)(H,17,18);/q;+1/p-1 |
| InChIKey | WIAOKEDKISNRMB-UHFFFAOYSA-M |
| XLogP | -1.73 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |