About (3S)-3-phenylbutanoate
(3S)-3-phenylbutanoate (PubChem CID 6950118) has the molecular formula C10H11O2-
and a molecular weight of 163.20 g/mol. Its IUPAC name is (3S)-3-phenylbutanoate.
Molecular Properties
| Compound Name | (3S)-3-phenylbutanoate |
| PubChem CID | 6950118 |
| Molecular Formula | C10H11O2- |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (3S)-3-phenylbutanoate |
| SMILES | C[C@@H](CC(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12)/p-1/t8-/m0/s1 |
| InChIKey | ZZEWMYILWXCRHZ-QMMMGPOBSA-M |
| XLogP | 0.93 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-phenylbutanoate?
The IUPAC name of (3S)-3-phenylbutanoate (CID 6950118) is (3S)-3-phenylbutanoate.
What is the SMILES notation for (3S)-3-phenylbutanoate?
The canonical SMILES for (3S)-3-phenylbutanoate is C[C@@H](CC(=O)[O-])c1ccccc1.
What is the InChIKey of (3S)-3-phenylbutanoate?
The InChIKey is ZZEWMYILWXCRHZ-QMMMGPOBSA-M. The full InChI is InChI=1S/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12)/p-1/t8-/m0/s1.
What are the key properties of (3S)-3-phenylbutanoate?
(3S)-3-phenylbutanoate has a molecular weight of 163.20 g/mol, XLogP of 0.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-phenylbutanoate is sourced from PubChem (CID 6950118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).