About 4-oxo-3-phenylpentanoate
4-oxo-3-phenylpentanoate (PubChem CID 78435368) has the molecular formula C11H11O3-
and a molecular weight of 191.21 g/mol. Its IUPAC name is 4-oxo-3-phenylpentanoate.
Molecular Properties
| Compound Name | 4-oxo-3-phenylpentanoate |
| PubChem CID | 78435368 |
| Molecular Formula | C11H11O3- |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-oxo-3-phenylpentanoate |
| SMILES | CC(=O)C(CC(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C11H12O3/c1-8(12)10(7-11(13)14)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,13,14)/p-1 |
| InChIKey | XXFBNFPEZIQQFY-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxo-3-phenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3-phenylpentanoate?
The IUPAC name of 4-oxo-3-phenylpentanoate (CID 78435368) is 4-oxo-3-phenylpentanoate.
What is the SMILES notation for 4-oxo-3-phenylpentanoate?
The canonical SMILES for 4-oxo-3-phenylpentanoate is CC(=O)C(CC(=O)[O-])c1ccccc1.
What is the InChIKey of 4-oxo-3-phenylpentanoate?
The InChIKey is XXFBNFPEZIQQFY-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H12O3/c1-8(12)10(7-11(13)14)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,13,14)/p-1.
What are the key properties of 4-oxo-3-phenylpentanoate?
4-oxo-3-phenylpentanoate has a molecular weight of 191.21 g/mol, XLogP of 0.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3-phenylpentanoate is sourced from PubChem (CID 78435368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).