C11H12NO4- — CID 7086103
(2S,3R)-2-azaniumyl-3-phenylpentanedioate (PubChem CID 7086103) has the molecular formula C11H12NO4- and a molecular weight of 222.22 g/mol. Its IUPAC name is (2S,3R)-2-azaniumyl-3-phenylpentanedioate.
| Compound Name | (2S,3R)-2-azaniumyl-3-phenylpentanedioate |
|---|---|
| PubChem CID | 7086103 |
| Molecular Formula | C11H12NO4- |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (2S,3R)-2-azaniumyl-3-phenylpentanedioate |
| SMILES | [NH3+][C@H](C(=O)[O-])[C@H](CC(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C11H13NO4/c12-10(11(15)16)8(6-9(13)14)7-4-2-1-3-5-7/h1-5,8,10H,6,12H2,(H,13,14)(H,15,16)/p-1/t8-,10+/m1/s1 |
| InChIKey | UXEDFOHTFRNIJS-SCZZXKLOSA-M |
| XLogP | -2.73 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |