C16H13O3- — CID 6950858
(2S)-4-oxo-2,4-diphenylbutanoate (PubChem CID 6950858) has the molecular formula C16H13O3- and a molecular weight of 253.28 g/mol. Its IUPAC name is (2S)-4-oxo-2,4-diphenylbutanoate.
| Compound Name | (2S)-4-oxo-2,4-diphenylbutanoate |
|---|---|
| PubChem CID | 6950858 |
| Molecular Formula | C16H13O3- |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (2S)-4-oxo-2,4-diphenylbutanoate |
| SMILES | O=C(C[C@H](C(=O)[O-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14O3/c17-15(13-9-5-2-6-10-13)11-14(16(18)19)12-7-3-1-4-8-12/h1-10,14H,11H2,(H,18,19)/p-1/t14-/m0/s1 |
| InChIKey | BTJVYXJKBFVHPY-AWEZNQCLSA-M |
| XLogP | 1.79 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |