C15H13O2- — CID 6993748
(2S)-2,3-diphenylpropanoate (PubChem CID 6993748) has the molecular formula C15H13O2- and a molecular weight of 225.27 g/mol. Its IUPAC name is (2S)-2,3-diphenylpropanoate.
| Compound Name | (2S)-2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 6993748 |
| Molecular Formula | C15H13O2- |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (2S)-2,3-diphenylpropanoate |
| SMILES | O=C([O-])[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,16,17)/p-1/t14-/m0/s1 |
| InChIKey | PCRICPYPVZKEBZ-AWEZNQCLSA-M |
| XLogP | 1.76 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |