C17H19AlO — CID 173146951
1-ethylalumanyl-2,3-diphenylpropan-1-one (PubChem CID 173146951) has the molecular formula C17H19AlO and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-ethylalumanyl-2,3-diphenylpropan-1-one.
| Compound Name | 1-ethylalumanyl-2,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 173146951 |
| Molecular Formula | C17H19AlO |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-ethylalumanyl-2,3-diphenylpropan-1-one |
| SMILES | CC[AlH]C(=O)C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13O.C2H5.Al.H/c16-12-15(14-9-5-2-6-10-14)11-13-7-3-1-4-8-13;1-2;;/h1-10,15H,11H2;1H2,2H3;; |
| InChIKey | WEFIVHFKLCYDPM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |