C25H26O — CID 135032816
1-(4-tert-butylphenyl)-2,3-diphenylpropan-1-one (PubChem CID 135032816) has the molecular formula C25H26O and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2,3-diphenylpropan-1-one.
| Compound Name | 1-(4-tert-butylphenyl)-2,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 135032816 |
| Molecular Formula | C25H26O |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2,3-diphenylpropan-1-one |
| SMILES | CC(C)(C)c1ccc(C(=O)C(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26O/c1-25(2,3)22-16-14-21(15-17-22)24(26)23(20-12-8-5-9-13-20)18-19-10-6-4-7-11-19/h4-17,23H,18H2,1-3H3 |
| InChIKey | QVXSZKFEECLXDS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |