C26H37NO — CID 154665958
1-(4-tert-butylphenyl)-4-(dimethylamino)-2-phenylpentan-1-one;prop-1-ene (PubChem CID 154665958) has the molecular formula C26H37NO and a molecular weight of 379.59 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-4-(dimethylamino)-2-phenylpentan-1-one;prop-1-ene.
| Compound Name | 1-(4-tert-butylphenyl)-4-(dimethylamino)-2-phenylpentan-1-one;prop-1-ene |
|---|---|
| PubChem CID | 154665958 |
| Molecular Formula | C26H37NO |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | 1-(4-tert-butylphenyl)-4-(dimethylamino)-2-phenylpentan-1-one;prop-1-ene |
| SMILES | C=CC.CC(CC(C(=O)c1ccc(C(C)(C)C)cc1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C23H31NO.C3H6/c1-17(24(5)6)16-21(18-10-8-7-9-11-18)22(25)19-12-14-20(15-13-19)23(2,3)4;1-3-2/h7-15,17,21H,16H2,1-6H3;3H,1H2,2H3 |
| InChIKey | MPQYWNPRDDSITG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|