C17H25NO — CID 154665907
(E,6S,8S)-8-(dimethylamino)-6-phenylnon-2-en-5-one (PubChem CID 154665907) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (E,6S,8S)-8-(dimethylamino)-6-phenylnon-2-en-5-one.
| Compound Name | (E,6S,8S)-8-(dimethylamino)-6-phenylnon-2-en-5-one |
|---|---|
| PubChem CID | 154665907 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (E,6S,8S)-8-(dimethylamino)-6-phenylnon-2-en-5-one |
| SMILES | C/C=C/CC(=O)[C@@H](C[C@H](C)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO/c1-5-6-12-17(19)16(13-14(2)18(3)4)15-10-8-7-9-11-15/h5-11,14,16H,12-13H2,1-4H3/b6-5+/t14-,16-/m0/s1 |
| InChIKey | MZJHSULUONBQBE-NCVJHSOJSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|