C14H21NO2 — CID 22270428
N-methoxy-N,4-dimethyl-2-phenylpentanamide (PubChem CID 22270428) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N-methoxy-N,4-dimethyl-2-phenylpentanamide.
| Compound Name | N-methoxy-N,4-dimethyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 22270428 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-methoxy-N,4-dimethyl-2-phenylpentanamide |
| SMILES | CON(C)C(=O)C(CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-11(2)10-13(14(16)15(3)17-4)12-8-6-5-7-9-12/h5-9,11,13H,10H2,1-4H3 |
| InChIKey | OSNBLBVHIQCURK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|