C9H19NO2 — CID 161245608
N-methoxy-N,2,4-trimethylpentanamide (PubChem CID 161245608) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is N-methoxy-N,2,4-trimethylpentanamide.
| Compound Name | N-methoxy-N,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 161245608 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | N-methoxy-N,2,4-trimethylpentanamide |
| SMILES | CON(C)C(=O)C(C)CC(C)C |
| InChI | InChI=1S/C9H19NO2/c1-7(2)6-8(3)9(11)10(4)12-5/h7-8H,6H2,1-5H3 |
| InChIKey | QUDVXTXNMSOCPL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|