C12H15F2NO2 — CID 23589518
3-(3,5-difluorophenyl)-N-methoxy-N,2-dimethylpropanamide (PubChem CID 23589518) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-N-methoxy-N,2-dimethylpropanamide.
| Compound Name | 3-(3,5-difluorophenyl)-N-methoxy-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 23589518 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-(3,5-difluorophenyl)-N-methoxy-N,2-dimethylpropanamide |
| SMILES | CON(C)C(=O)C(C)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2NO2/c1-8(12(16)15(2)17-3)4-9-5-10(13)7-11(14)6-9/h5-8H,4H2,1-3H3 |
| InChIKey | UZBLURXCOVFYKS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|