C10H11F2NO3 — CID 91620381
2-(3,5-difluorophenoxy)-N-methoxy-N-methylacetamide (PubChem CID 91620381) has the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. Its IUPAC name is 2-(3,5-difluorophenoxy)-N-methoxy-N-methylacetamide.
| Compound Name | 2-(3,5-difluorophenoxy)-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 91620381 |
| Molecular Formula | C10H11F2NO3 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-(3,5-difluorophenoxy)-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)COc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H11F2NO3/c1-13(15-2)10(14)6-16-9-4-7(11)3-8(12)5-9/h3-5H,6H2,1-2H3 |
| InChIKey | MIUBWIZLGRVANS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|