C12H14F2O2 — CID 62784864
1-(3,5-difluorophenoxy)-3,3-dimethylbutan-2-one (PubChem CID 62784864) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 1-(3,5-difluorophenoxy)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(3,5-difluorophenoxy)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 62784864 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-(3,5-difluorophenoxy)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)COc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H14F2O2/c1-12(2,3)11(15)7-16-10-5-8(13)4-9(14)6-10/h4-6H,7H2,1-3H3 |
| InChIKey | QHTNNSTYAOWTDZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |