About 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide
3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide (PubChem CID 176703397) has the molecular formula C11H13F2NO2
and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide |
| PubChem CID | 176703397 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCOc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H13F2NO2/c1-14(2)11(15)3-4-16-10-6-8(12)5-9(13)7-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | OWMKLNHIFCGIHG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide?
The IUPAC name of 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide (CID 176703397) is 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide.
What is the SMILES notation for 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide?
The canonical SMILES for 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide is CN(C)C(=O)CCOc1cc(F)cc(F)c1.
What is the InChIKey of 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide?
The InChIKey is OWMKLNHIFCGIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO2/c1-14(2)11(15)3-4-16-10-6-8(12)5-9(13)7-10/h5-7H,3-4H2,1-2H3.
What are the key properties of 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide?
3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide has a molecular weight of 229.23 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenoxy)-N,N-dimethylpropanamide is sourced from PubChem (CID 176703397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).