C13H16N2O3 — CID 103567047
3-(3-cyano-5-methoxyphenoxy)-N,N-dimethylpropanamide (PubChem CID 103567047) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-(3-cyano-5-methoxyphenoxy)-N,N-dimethylpropanamide.
| Compound Name | 3-(3-cyano-5-methoxyphenoxy)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 103567047 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-(3-cyano-5-methoxyphenoxy)-N,N-dimethylpropanamide |
| SMILES | COc1cc(C#N)cc(OCCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H16N2O3/c1-15(2)13(16)4-5-18-12-7-10(9-14)6-11(8-12)17-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | YLSZGQASELBOOG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |