C9H10F2O3S — CID 165179665
(2R)-1-(3,5-difluorophenyl)propane-2-sulfonic acid (PubChem CID 165179665) has the molecular formula C9H10F2O3S and a molecular weight of 236.24 g/mol. Its IUPAC name is (2R)-1-(3,5-difluorophenyl)propane-2-sulfonic acid.
| Compound Name | (2R)-1-(3,5-difluorophenyl)propane-2-sulfonic acid |
|---|---|
| PubChem CID | 165179665 |
| Molecular Formula | C9H10F2O3S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (2R)-1-(3,5-difluorophenyl)propane-2-sulfonic acid |
| SMILES | C[C@H](Cc1cc(F)cc(F)c1)S(=O)(=O)O |
| InChI | InChI=1S/C9H10F2O3S/c1-6(15(12,13)14)2-7-3-8(10)5-9(11)4-7/h3-6H,2H2,1H3,(H,12,13,14)/t6-/m1/s1 |
| InChIKey | LKZPJVCVSDTMFN-ZCFIWIBFSA-N |
| XLogP | 1.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|